C12H18BrClN2O2S — CID 106118270
5-bromo-N-[2-(2-chloroethyl)pentyl]pyridine-3-sulfonamide (PubChem CID 106118270) has the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-chloroethyl)pentyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-N-[2-(2-chloroethyl)pentyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106118270 |
| Molecular Formula | C12H18BrClN2O2S |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-bromo-N-[2-(2-chloroethyl)pentyl]pyridine-3-sulfonamide |
| SMILES | CCCC(CCCl)CNS(=O)(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C12H18BrClN2O2S/c1-2-3-10(4-5-14)7-16-19(17,18)12-6-11(13)8-15-9-12/h6,8-10,16H,2-5,7H2,1H3 |
| InChIKey | JWUKFGBJIPVEGX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|