C15H24ClNO2S — CID 106118251
N-[2-(2-chloroethyl)pentyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 106118251) has the molecular formula C15H24ClNO2S and a molecular weight of 317.88 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106118251 |
| Molecular Formula | C15H24ClNO2S |
| Molecular Weight | 317.88 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | CCCC(CCCl)CNS(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C15H24ClNO2S/c1-4-5-14(8-9-16)11-17-20(18,19)15-7-6-12(2)10-13(15)3/h6-7,10,14,17H,4-5,8-9,11H2,1-3H3 |
| InChIKey | WNCAMTFHBSTGIB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|