C8H14N2O4S2 — CID 103414719
N-(2,2-dimethoxyethyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103414719) has the molecular formula C8H14N2O4S2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103414719 |
| Molecular Formula | C8H14N2O4S2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | COC(CNS(=O)(=O)c1cnc(C)s1)OC |
| InChI | InChI=1S/C8H14N2O4S2/c1-6-9-5-8(15-6)16(11,12)10-4-7(13-2)14-3/h5,7,10H,4H2,1-3H3 |
| InChIKey | WBQOJTKXBKVQLZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|