C11H19BrN2O2S2 — CID 114168907
N-(2-bromo-3-ethylpentyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 114168907) has the molecular formula C11H19BrN2O2S2 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 114168907 |
| Molecular Formula | C11H19BrN2O2S2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(CC)C(Br)CNS(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C11H19BrN2O2S2/c1-4-9(5-2)10(12)6-14-18(15,16)11-7-13-8(3)17-11/h7,9-10,14H,4-6H2,1-3H3 |
| InChIKey | CWJVWROOMDTVJP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|