C17H18N2O4S2 — CID 58808571
5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 58808571) has the molecular formula C17H18N2O4S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58808571 |
| Molecular Formula | C17H18N2O4S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CCc1cc(-c2ccc(S(=O)(=O)NCc3ccco3)s2)c(C)[nH]c1=O |
| InChI | InChI=1S/C17H18N2O4S2/c1-3-12-9-14(11(2)19-17(12)20)15-6-7-16(24-15)25(21,22)18-10-13-5-4-8-23-13/h4-9,18H,3,10H2,1-2H3,(H,19,20) |
| InChIKey | XMLCYRKJQDERPQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |