C20H22N2O4S2 — CID 58808634
5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(2-phenoxyethyl)thiophene-2-sulfonamide (PubChem CID 58808634) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(2-phenoxyethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(2-phenoxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58808634 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)-N-(2-phenoxyethyl)thiophene-2-sulfonamide |
| SMILES | CCc1cc(-c2ccc(S(=O)(=O)NCCOc3ccccc3)s2)c(C)[nH]c1=O |
| InChI | InChI=1S/C20H22N2O4S2/c1-3-15-13-17(14(2)22-20(15)23)18-9-10-19(27-18)28(24,25)21-11-12-26-16-7-5-4-6-8-16/h4-10,13,21H,3,11-12H2,1-2H3,(H,22,23) |
| InChIKey | ARKZDDLIBWTMAD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|