C7H7N3OS — CID 68957437
5-(furan-2-ylmethylsulfanyl)-1H-1,2,4-triazole (PubChem CID 68957437) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-(furan-2-ylmethylsulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(furan-2-ylmethylsulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 68957437 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-(furan-2-ylmethylsulfanyl)-1H-1,2,4-triazole |
| SMILES | c1coc(CSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C7H7N3OS/c1-2-6(11-3-1)4-12-7-8-5-9-10-7/h1-3,5H,4H2,(H,8,9,10) |
| InChIKey | VZBQNRAZHJXDLR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |