C7H7N3O2 — CID 115004217
5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-amine (PubChem CID 115004217) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 115004217 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(Cc2ccco2)n1 |
| InChI | InChI=1S/C7H7N3O2/c8-7-9-6(12-10-7)4-5-2-1-3-11-5/h1-3H,4H2,(H2,8,10) |
| InChIKey | REUBJOSQQXQDHC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |