About 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid
2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid (PubChem CID 115079625) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid.
Analyze 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid (CID 115079625) is 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid is O=C(O)Cc1noc(Cc2ccco2)n1.
What is the InChIKey of 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The InChIKey is LDOKFVGYQUTSOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c12-9(13)5-7-10-8(15-11-7)4-6-2-1-3-14-6/h1-3H,4-5H2,(H,12,13).
What are the key properties of 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid has a molecular weight of 208.17 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-ylmethyl)-1,2,4-oxadiazol-3-yl]acetic acid is sourced from PubChem (CID 115079625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).