About [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine
[3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 115004199) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine.
Analyze [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The IUPAC name of [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine (CID 115004199) is [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine.
What is the SMILES notation for [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The canonical SMILES for [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine is NCc1nc(Cc2ccco2)no1.
What is the InChIKey of [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The InChIKey is RNDYXCBFIZPCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c9-5-8-10-7(11-13-8)4-6-2-1-3-12-6/h1-3H,4-5,9H2.
What are the key properties of [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine?
[3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine has a molecular weight of 179.18 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(furan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]methanamine is sourced from PubChem (CID 115004199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).