C13H21NO2 — CID 115034079
3-(5-cycloheptyl-1,3-oxazol-2-yl)propan-1-ol (PubChem CID 115034079) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(5-cycloheptyl-1,3-oxazol-2-yl)propan-1-ol.
| Compound Name | 3-(5-cycloheptyl-1,3-oxazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 115034079 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-(5-cycloheptyl-1,3-oxazol-2-yl)propan-1-ol |
| SMILES | OCCCc1ncc(C2CCCCCC2)o1 |
| InChI | InChI=1S/C13H21NO2/c15-9-5-8-13-14-10-12(16-13)11-6-3-1-2-4-7-11/h10-11,15H,1-9H2 |
| InChIKey | AUGQVKFQVXPQHL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |