C7H12N2O2 — CID 115084839
3-[5-(aminomethyl)-1,3-oxazol-2-yl]propan-1-ol (PubChem CID 115084839) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,3-oxazol-2-yl]propan-1-ol.
| Compound Name | 3-[5-(aminomethyl)-1,3-oxazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 115084839 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-[5-(aminomethyl)-1,3-oxazol-2-yl]propan-1-ol |
| SMILES | NCc1cnc(CCCO)o1 |
| InChI | InChI=1S/C7H12N2O2/c8-4-6-5-9-7(11-6)2-1-3-10/h5,10H,1-4,8H2 |
| InChIKey | GMJJQVOMACAMJC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |