C9H10N2OS — CID 115087573
[2-(thiophen-2-ylmethyl)-1,3-oxazol-5-yl]methanamine (PubChem CID 115087573) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is [2-(thiophen-2-ylmethyl)-1,3-oxazol-5-yl]methanamine.
| Compound Name | [2-(thiophen-2-ylmethyl)-1,3-oxazol-5-yl]methanamine |
|---|---|
| PubChem CID | 115087573 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | [2-(thiophen-2-ylmethyl)-1,3-oxazol-5-yl]methanamine |
| SMILES | NCc1cnc(Cc2cccs2)o1 |
| InChI | InChI=1S/C9H10N2OS/c10-5-7-6-11-9(12-7)4-8-2-1-3-13-8/h1-3,6H,4-5,10H2 |
| InChIKey | NRFWIOPLUZYNQQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |