C7H7N3OS — CID 16768121
5-(thiophen-2-ylmethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 16768121) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 5-(thiophen-2-ylmethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(thiophen-2-ylmethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 16768121 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 5-(thiophen-2-ylmethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(Cc2cccs2)o1 |
| InChI | InChI=1S/C7H7N3OS/c8-7-10-9-6(11-7)4-5-2-1-3-12-5/h1-3H,4H2,(H2,8,10) |
| InChIKey | QMFOBSJYPCYCOP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |