C6H5N3OS — CID 16767328
5-thiophen-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 16767328) has the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. Its IUPAC name is 5-thiophen-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-thiophen-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 16767328 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 5-thiophen-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C6H5N3OS/c7-6-9-8-5(10-6)4-2-1-3-11-4/h1-3H,(H2,7,9) |
| InChIKey | XNRKGPFTYJTUJZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |