C7H6N2O2S — CID 43558918
(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methanol (PubChem CID 43558918) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methanol.
| Compound Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methanol |
|---|---|
| PubChem CID | 43558918 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | (5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methanol |
| SMILES | OCc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C7H6N2O2S/c10-4-6-8-9-7(11-6)5-2-1-3-12-5/h1-3,10H,4H2 |
| InChIKey | GDCRJCZPPYVPKZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |