C7H13ClN2O — CID 66588553
2-(5-ethyl-1,3-oxazol-2-yl)ethanamine;hydrochloride (PubChem CID 66588553) has the molecular formula C7H13ClN2O and a molecular weight of 176.65 g/mol. Its IUPAC name is 2-(5-ethyl-1,3-oxazol-2-yl)ethanamine;hydrochloride.
| Compound Name | 2-(5-ethyl-1,3-oxazol-2-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 66588553 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-(5-ethyl-1,3-oxazol-2-yl)ethanamine;hydrochloride |
| SMILES | CCc1cnc(CCN)o1.Cl |
| InChI | InChI=1S/C7H12N2O.ClH/c1-2-6-5-9-7(10-6)3-4-8;/h5H,2-4,8H2,1H3;1H |
| InChIKey | RFVMFEVRMBBYJS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |