About 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine
2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 65178534) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine |
| PubChem CID | 65178534 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | NCCc1ncc(CCc2ccccc2)o1 |
| InChI | InChI=1S/C13H16N2O/c14-9-8-13-15-10-12(16-13)7-6-11-4-2-1-3-5-11/h1-5,10H,6-9,14H2 |
| InChIKey | OOWWTWRRWMXIIL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine?
The IUPAC name of 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine (CID 65178534) is 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine.
What is the SMILES notation for 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine?
The canonical SMILES for 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine is NCCc1ncc(CCc2ccccc2)o1.
What is the InChIKey of 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine?
The InChIKey is OOWWTWRRWMXIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c14-9-8-13-15-10-12(16-13)7-6-11-4-2-1-3-5-11/h1-5,10H,6-9,14H2.
What are the key properties of 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine?
2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine has a molecular weight of 216.28 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-phenylethyl)-1,3-oxazol-2-yl]ethanamine is sourced from PubChem (CID 65178534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).