C6H9FN2O — CID 84762830
2-[2-(fluoromethyl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 84762830) has the molecular formula C6H9FN2O and a molecular weight of 144.15 g/mol. Its IUPAC name is 2-[2-(fluoromethyl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 2-[2-(fluoromethyl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 84762830 |
| Molecular Formula | C6H9FN2O |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-[2-(fluoromethyl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | NCCc1cnc(CF)o1 |
| InChI | InChI=1S/C6H9FN2O/c7-3-6-9-4-5(10-6)1-2-8/h4H,1-3,8H2 |
| InChIKey | UIYYJLREZGZKOG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |