C7H12N2O2 — CID 115084892
2-[5-(2-aminoethyl)-1,3-oxazol-2-yl]ethanol (PubChem CID 115084892) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-[5-(2-aminoethyl)-1,3-oxazol-2-yl]ethanol.
| Compound Name | 2-[5-(2-aminoethyl)-1,3-oxazol-2-yl]ethanol |
|---|---|
| PubChem CID | 115084892 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-[5-(2-aminoethyl)-1,3-oxazol-2-yl]ethanol |
| SMILES | NCCc1cnc(CCO)o1 |
| InChI | InChI=1S/C7H12N2O2/c8-3-1-6-5-9-7(11-6)2-4-10/h5,10H,1-4,8H2 |
| InChIKey | CCIRKLLIBROSPY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |