C9H14N2O2 — CID 115016152
(5-piperidin-4-yl-1,3-oxazol-2-yl)methanol (PubChem CID 115016152) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (5-piperidin-4-yl-1,3-oxazol-2-yl)methanol.
| Compound Name | (5-piperidin-4-yl-1,3-oxazol-2-yl)methanol |
|---|---|
| PubChem CID | 115016152 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (5-piperidin-4-yl-1,3-oxazol-2-yl)methanol |
| SMILES | OCc1ncc(C2CCNCC2)o1 |
| InChI | InChI=1S/C9H14N2O2/c12-6-9-11-5-8(13-9)7-1-3-10-4-2-7/h5,7,10,12H,1-4,6H2 |
| InChIKey | KEBJUXDSVSDABW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |