C10H16N2O2 — CID 115020647
(5-methyl-4-piperidin-4-yl-1,3-oxazol-2-yl)methanol (PubChem CID 115020647) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (5-methyl-4-piperidin-4-yl-1,3-oxazol-2-yl)methanol.
| Compound Name | (5-methyl-4-piperidin-4-yl-1,3-oxazol-2-yl)methanol |
|---|---|
| PubChem CID | 115020647 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (5-methyl-4-piperidin-4-yl-1,3-oxazol-2-yl)methanol |
| SMILES | Cc1oc(CO)nc1C1CCNCC1 |
| InChI | InChI=1S/C10H16N2O2/c1-7-10(12-9(6-13)14-7)8-2-4-11-5-3-8/h8,11,13H,2-6H2,1H3 |
| InChIKey | QUXCGOTWJMEKFZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |