C10H15NO2S — CID 115028422
[5-methyl-4-(thian-4-yl)-1,3-oxazol-2-yl]methanol (PubChem CID 115028422) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is [5-methyl-4-(thian-4-yl)-1,3-oxazol-2-yl]methanol.
| Compound Name | [5-methyl-4-(thian-4-yl)-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 115028422 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | [5-methyl-4-(thian-4-yl)-1,3-oxazol-2-yl]methanol |
| SMILES | Cc1oc(CO)nc1C1CCSCC1 |
| InChI | InChI=1S/C10H15NO2S/c1-7-10(11-9(6-12)13-7)8-2-4-14-5-3-8/h8,12H,2-6H2,1H3 |
| InChIKey | CEYRMFAXRSIHPS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |