4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid

C8H9NO3 — CID 105433312

IUPAC4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid
SMILESCc1oc(C(=O)O)nc1C1CC1
InChIInChI=1S/C8H9NO3/c1-4-6(5-2-3-5)9-7(12-4)8(10)11/h5H,2-3H2,1H3,(H,10,11)
InChIKeyXCVCBEPGSDIAOD-UHFFFAOYSA-N
MW167.16 g/mol
LogP1.56
Rot. Bonds2

About 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid

4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid (PubChem CID 105433312) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid.

Molecular Properties

Compound Name4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid
PubChem CID105433312
Molecular FormulaC8H9NO3
Molecular Weight167.16 g/mol
Exact Mass167.06
IUPAC Name4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid
SMILESCc1oc(C(=O)O)nc1C1CC1
InChIInChI=1S/C8H9NO3/c1-4-6(5-2-3-5)9-7(12-4)8(10)11/h5H,2-3H2,1H3,(H,10,11)
InChIKeyXCVCBEPGSDIAOD-UHFFFAOYSA-N
XLogP1.56
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.16
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid (CID 105433312) is 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid is Cc1oc(C(=O)O)nc1C1CC1.
What is the InChIKey of 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid?
The InChIKey is XCVCBEPGSDIAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-4-6(5-2-3-5)9-7(12-4)8(10)11/h5H,2-3H2,1H3,(H,10,11).
What are the key properties of 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid?
4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid has a molecular weight of 167.16 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-methyl-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 105433312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).