About 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid
4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid (PubChem CID 105440602) has the molecular formula C8H9NO2S
and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid.
Analyze 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid (CID 105440602) is 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid is Cc1sc(C(=O)O)nc1C1CC1.
What is the InChIKey of 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid?
The InChIKey is JJLFIVHYSFITPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2S/c1-4-6(5-2-3-5)9-7(12-4)8(10)11/h5H,2-3H2,1H3,(H,10,11).
What are the key properties of 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid?
4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid has a molecular weight of 183.23 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-methyl-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 105440602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).