2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid

C10H14N2O2S — CID 105484003

IUPAC2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C2CCNCC2)c(C(=O)O)s1
InChIInChI=1S/C10H14N2O2S/c1-6-12-8(9(15-6)10(13)14)7-2-4-11-5-3-7/h7,11H,2-5H2,1H3,(H,13,14)
InChIKeyWPCVCRYYNLDHGC-UHFFFAOYSA-N
MW226.30 g/mol
LogP1.62
Rot. Bonds2

About 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid

2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 105484003) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid
PubChem CID105484003
Molecular FormulaC10H14N2O2S
Molecular Weight226.30 g/mol
Exact Mass226.08
IUPAC Name2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C2CCNCC2)c(C(=O)O)s1
InChIInChI=1S/C10H14N2O2S/c1-6-12-8(9(15-6)10(13)14)7-2-4-11-5-3-7/h7,11H,2-5H2,1H3,(H,13,14)
InChIKeyWPCVCRYYNLDHGC-UHFFFAOYSA-N
XLogP1.62
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.30
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid (CID 105484003) is 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid is Cc1nc(C2CCNCC2)c(C(=O)O)s1.
What is the InChIKey of 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is WPCVCRYYNLDHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-6-12-8(9(15-6)10(13)14)7-2-4-11-5-3-7/h7,11H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid?
2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 226.30 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 105484003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).