C10H14N2O2S — CID 105484003
2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 105484003) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 105484003 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-methyl-4-piperidin-4-yl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(C2CCNCC2)c(C(=O)O)s1 |
| InChI | InChI=1S/C10H14N2O2S/c1-6-12-8(9(15-6)10(13)14)7-2-4-11-5-3-7/h7,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | WPCVCRYYNLDHGC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |