C8H8ClNO2S — CID 105471885
2-chloro-4-cyclobutyl-1,3-thiazole-5-carboxylic acid (PubChem CID 105471885) has the molecular formula C8H8ClNO2S and a molecular weight of 217.68 g/mol. Its IUPAC name is 2-chloro-4-cyclobutyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-chloro-4-cyclobutyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 105471885 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2-chloro-4-cyclobutyl-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(Cl)nc1C1CCC1 |
| InChI | InChI=1S/C8H8ClNO2S/c9-8-10-5(4-2-1-3-4)6(13-8)7(11)12/h4H,1-3H2,(H,11,12) |
| InChIKey | HWZOJNQJAYLVBZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |