C9H11NO2S — CID 64982497
2-cyclobutyl-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 64982497) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-cyclobutyl-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-cyclobutyl-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64982497 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-cyclobutyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(C2CCC2)sc1C(=O)O |
| InChI | InChI=1S/C9H11NO2S/c1-5-7(9(11)12)13-8(10-5)6-3-2-4-6/h6H,2-4H2,1H3,(H,11,12) |
| InChIKey | YDGMUOHBNDVBFL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |