C15H23NO2S — CID 114359658
2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid (PubChem CID 114359658) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114359658 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCc1nc(C2CCCCCCC2)sc1C(=O)O |
| InChI | InChI=1S/C15H23NO2S/c1-2-8-12-13(15(17)18)19-14(16-12)11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,17,18) |
| InChIKey | YDVJRUDDOCPWGU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |