2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid

C15H23NO2S — CID 114359658

IUPAC2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid
SMILESCCCc1nc(C2CCCCCCC2)sc1C(=O)O
InChIInChI=1S/C15H23NO2S/c1-2-8-12-13(15(17)18)19-14(16-12)11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,17,18)
InChIKeyYDVJRUDDOCPWGU-UHFFFAOYSA-N
MW281.42 g/mol
LogP4.62
Rot. Bonds4

About 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid

2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid (PubChem CID 114359658) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid
PubChem CID114359658
Molecular FormulaC15H23NO2S
Molecular Weight281.42 g/mol
Exact Mass281.14
IUPAC Name2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid
SMILESCCCc1nc(C2CCCCCCC2)sc1C(=O)O
InChIInChI=1S/C15H23NO2S/c1-2-8-12-13(15(17)18)19-14(16-12)11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,17,18)
InChIKeyYDVJRUDDOCPWGU-UHFFFAOYSA-N
XLogP4.62
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.42
LogP ≤ 54.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid (CID 114359658) is 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid is CCCc1nc(C2CCCCCCC2)sc1C(=O)O.
What is the InChIKey of 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is YDVJRUDDOCPWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2S/c1-2-8-12-13(15(17)18)19-14(16-12)11-9-6-4-3-5-7-10-11/h11H,2-10H2,1H3,(H,17,18).
What are the key properties of 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid?
2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 281.42 g/mol, XLogP of 4.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclooctyl-4-propyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 114359658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).