C14H21NOS — CID 82432421
1-(2-cyclohexyl-4-propyl-1,3-thiazol-5-yl)ethanone (PubChem CID 82432421) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(2-cyclohexyl-4-propyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-cyclohexyl-4-propyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 82432421 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-(2-cyclohexyl-4-propyl-1,3-thiazol-5-yl)ethanone |
| SMILES | CCCc1nc(C2CCCCC2)sc1C(C)=O |
| InChI | InChI=1S/C14H21NOS/c1-3-7-12-13(10(2)16)17-14(15-12)11-8-5-4-6-9-11/h11H,3-9H2,1-2H3 |
| InChIKey | SCGRUCPFDCBOMD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |