C9H11NO2S2 — CID 115037360
2-methyl-4-(thiolan-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 115037360) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-methyl-4-(thiolan-2-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-methyl-4-(thiolan-2-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 115037360 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 2-methyl-4-(thiolan-2-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(C2CCCS2)c(C(=O)O)s1 |
| InChI | InChI=1S/C9H11NO2S2/c1-5-10-7(6-3-2-4-13-6)8(14-5)9(11)12/h6H,2-4H2,1H3,(H,11,12) |
| InChIKey | FTGIXFKHQXTMFS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |