C10H14N4OS — CID 116648082
4-amino-6-methyl-2-(thiolan-2-yl)pyrimidine-5-carboxamide (PubChem CID 116648082) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 4-amino-6-methyl-2-(thiolan-2-yl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-6-methyl-2-(thiolan-2-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 116648082 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-amino-6-methyl-2-(thiolan-2-yl)pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C2CCCS2)nc(N)c1C(N)=O |
| InChI | InChI=1S/C10H14N4OS/c1-5-7(9(12)15)8(11)14-10(13-5)6-3-2-4-16-6/h6H,2-4H2,1H3,(H2,12,15)(H2,11,13,14) |
| InChIKey | LTZQTTQKWGWPCZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |