C11H15N3O2S — CID 116646799
ethyl 4-amino-2-(thiolan-2-yl)pyrimidine-5-carboxylate (PubChem CID 116646799) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is ethyl 4-amino-2-(thiolan-2-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(thiolan-2-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116646799 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | ethyl 4-amino-2-(thiolan-2-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C2CCCS2)nc1N |
| InChI | InChI=1S/C11H15N3O2S/c1-2-16-11(15)7-6-13-10(14-9(7)12)8-4-3-5-17-8/h6,8H,2-5H2,1H3,(H2,12,13,14) |
| InChIKey | RBOTZNOENBHIPA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |