C12H16N2O2S2 — CID 114244948
ethyl 2-(1,4-dithian-2-yl)-5-methylpyrimidine-4-carboxylate (PubChem CID 114244948) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is ethyl 2-(1,4-dithian-2-yl)-5-methylpyrimidine-4-carboxylate.
| Compound Name | ethyl 2-(1,4-dithian-2-yl)-5-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 114244948 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | ethyl 2-(1,4-dithian-2-yl)-5-methylpyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C2CSCCS2)ncc1C |
| InChI | InChI=1S/C12H16N2O2S2/c1-3-16-12(15)10-8(2)6-13-11(14-10)9-7-17-4-5-18-9/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | NGLDFQDYRCLZOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |