C8H12N4O2 — CID 103123476
5-piperidin-4-yl-2H-triazole-4-carboxylic acid (PubChem CID 103123476) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-piperidin-4-yl-2H-triazole-4-carboxylic acid.
| Compound Name | 5-piperidin-4-yl-2H-triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103123476 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-piperidin-4-yl-2H-triazole-4-carboxylic acid |
| SMILES | O=C(O)c1n[nH]nc1C1CCNCC1 |
| InChI | InChI=1S/C8H12N4O2/c13-8(14)7-6(10-12-11-7)5-1-3-9-4-2-5/h5,9H,1-4H2,(H,13,14)(H,10,11,12) |
| InChIKey | YAIMBVDDXPHFMA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |