2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid

C11H16N2O2S — CID 116868149

IUPAC2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid
SMILESCc1sc(CC(N)C(=O)O)nc1C1CCC1
InChIInChI=1S/C11H16N2O2S/c1-6-10(7-3-2-4-7)13-9(16-6)5-8(12)11(14)15/h7-8H,2-5,12H2,1H3,(H,14,15)
InChIKeyZMGXCGYJRRRBIA-UHFFFAOYSA-N
MW240.33 g/mol
LogP1.67
Rot. Bonds4

About 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid

2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 116868149) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid
PubChem CID116868149
Molecular FormulaC11H16N2O2S
Molecular Weight240.33 g/mol
Exact Mass240.09
IUPAC Name2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid
SMILESCc1sc(CC(N)C(=O)O)nc1C1CCC1
InChIInChI=1S/C11H16N2O2S/c1-6-10(7-3-2-4-7)13-9(16-6)5-8(12)11(14)15/h7-8H,2-5,12H2,1H3,(H,14,15)
InChIKeyZMGXCGYJRRRBIA-UHFFFAOYSA-N
XLogP1.67
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.33
LogP ≤ 51.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid (CID 116868149) is 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid is Cc1sc(CC(N)C(=O)O)nc1C1CCC1.
What is the InChIKey of 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid?
The InChIKey is ZMGXCGYJRRRBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-6-10(7-3-2-4-7)13-9(16-6)5-8(12)11(14)15/h7-8H,2-5,12H2,1H3,(H,14,15).
What are the key properties of 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid?
2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid has a molecular weight of 240.33 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(4-cyclobutyl-5-methyl-1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 116868149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).