C11H12N2O2S — CID 57034889
(2S)-2-amino-3-(5-methyl-1,3-benzothiazol-2-yl)propanoic acid (PubChem CID 57034889) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is (2S)-2-amino-3-(5-methyl-1,3-benzothiazol-2-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(5-methyl-1,3-benzothiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 57034889 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | (2S)-2-amino-3-(5-methyl-1,3-benzothiazol-2-yl)propanoic acid |
| SMILES | Cc1ccc2sc(C[C@H](N)C(=O)O)nc2c1 |
| InChI | InChI=1S/C11H12N2O2S/c1-6-2-3-9-8(4-6)13-10(16-9)5-7(12)11(14)15/h2-4,7H,5,12H2,1H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | HPPYIEAZVNHAIL-ZETCQYMHSA-N |
| XLogP | 1.56 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |