C6H7ClN2O2S — CID 107124426
2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid (PubChem CID 107124426) has the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. Its IUPAC name is 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 107124426 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid |
| SMILES | NC(Cc1ncc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C6H7ClN2O2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1,8H2,(H,10,11) |
| InChIKey | XOVLSDADIOEQNQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |