2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid

C6H7ClN2O2S — CID 107124426

IUPAC2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid
SMILESNC(Cc1ncc(Cl)s1)C(=O)O
InChIInChI=1S/C6H7ClN2O2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1,8H2,(H,10,11)
InChIKeyXOVLSDADIOEQNQ-UHFFFAOYSA-N
MW206.65 g/mol
LogP0.75
Rot. Bonds3

About 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid

2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid (PubChem CID 107124426) has the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. Its IUPAC name is 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid.

Molecular Properties

Compound Name2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid
PubChem CID107124426
Molecular FormulaC6H7ClN2O2S
Molecular Weight206.65 g/mol
Exact Mass205.99
IUPAC Name2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid
SMILESNC(Cc1ncc(Cl)s1)C(=O)O
InChIInChI=1S/C6H7ClN2O2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1,8H2,(H,10,11)
InChIKeyXOVLSDADIOEQNQ-UHFFFAOYSA-N
XLogP0.75
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.65
LogP ≤ 50.75
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid (CID 107124426) is 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid is NC(Cc1ncc(Cl)s1)C(=O)O.
What is the InChIKey of 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid?
The InChIKey is XOVLSDADIOEQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S/c7-4-2-9-5(12-4)1-3(8)6(10)11/h2-3H,1,8H2,(H,10,11).
What are the key properties of 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid?
2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid has a molecular weight of 206.65 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(5-chloro-1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 107124426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).