C8H8ClFN2O2 — CID 130749995
(2R)-2-amino-3-(5-chloro-2-fluoro-3-pyridinyl)propanoic acid (PubChem CID 130749995) has the molecular formula C8H8ClFN2O2 and a molecular weight of 218.62 g/mol. Its IUPAC name is (2R)-2-amino-3-(5-chloro-2-fluoro-3-pyridinyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(5-chloro-2-fluoro-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 130749995 |
| Molecular Formula | C8H8ClFN2O2 |
| Molecular Weight | 218.62 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (2R)-2-amino-3-(5-chloro-2-fluoro-3-pyridinyl)propanoic acid |
| SMILES | N[C@H](Cc1cc(Cl)cnc1F)C(=O)O |
| InChI | InChI=1S/C8H8ClFN2O2/c9-5-1-4(7(10)12-3-5)2-6(11)8(13)14/h1,3,6H,2,11H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | XGRAHPFQXRVKJA-ZCFIWIBFSA-N |
| XLogP | 0.83 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.62 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|