(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid

C8H8F2N2O2 — CID 131055961

IUPAC(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid
SMILESN[C@H](Cc1ncc(F)cc1F)C(=O)O
InChIInChI=1S/C8H8F2N2O2/c9-4-1-5(10)7(12-3-4)2-6(11)8(13)14/h1,3,6H,2,11H2,(H,13,14)/t6-/m1/s1
InChIKeyNNMPMHHFKRUGGQ-ZCFIWIBFSA-N
MW202.16 g/mol
LogP0.31
Rot. Bonds3

About (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid

(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid (PubChem CID 131055961) has the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. Its IUPAC name is (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid
PubChem CID131055961
Molecular FormulaC8H8F2N2O2
Molecular Weight202.16 g/mol
Exact Mass202.06
IUPAC Name(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid
SMILESN[C@H](Cc1ncc(F)cc1F)C(=O)O
InChIInChI=1S/C8H8F2N2O2/c9-4-1-5(10)7(12-3-4)2-6(11)8(13)14/h1,3,6H,2,11H2,(H,13,14)/t6-/m1/s1
InChIKeyNNMPMHHFKRUGGQ-ZCFIWIBFSA-N
XLogP0.31
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.16
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid?
The IUPAC name of (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid (CID 131055961) is (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid.
What is the SMILES notation for (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid?
The canonical SMILES for (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid is N[C@H](Cc1ncc(F)cc1F)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid?
The InChIKey is NNMPMHHFKRUGGQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8F2N2O2/c9-4-1-5(10)7(12-3-4)2-6(11)8(13)14/h1,3,6H,2,11H2,(H,13,14)/t6-/m1/s1.
What are the key properties of (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid?
(2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid has a molecular weight of 202.16 g/mol, XLogP of 0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-(3,5-difluoro-2-pyridinyl)propanoic acid is sourced from PubChem (CID 131055961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).