C9H7Cl4NO2 — CID 86089013
2-amino-3-(2,3,4,5-tetrachlorophenyl)propanoic acid (PubChem CID 86089013) has the molecular formula C9H7Cl4NO2 and a molecular weight of 302.97 g/mol. Its IUPAC name is 2-amino-3-(2,3,4,5-tetrachlorophenyl)propanoic acid.
| Compound Name | 2-amino-3-(2,3,4,5-tetrachlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 86089013 |
| Molecular Formula | C9H7Cl4NO2 |
| Molecular Weight | 302.97 g/mol |
| Exact Mass | 300.92 |
| IUPAC Name | 2-amino-3-(2,3,4,5-tetrachlorophenyl)propanoic acid |
| SMILES | NC(Cc1cc(Cl)c(Cl)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C9H7Cl4NO2/c10-4-1-3(2-5(14)9(15)16)6(11)8(13)7(4)12/h1,5H,2,14H2,(H,15,16) |
| InChIKey | GFSHDTAAIOEKMT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.97 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|