C9H11ClN2O2 — CID 130690220
(2R)-2-amino-3-(5-amino-2-chlorophenyl)propanoic acid (PubChem CID 130690220) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is (2R)-2-amino-3-(5-amino-2-chlorophenyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(5-amino-2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 130690220 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (2R)-2-amino-3-(5-amino-2-chlorophenyl)propanoic acid |
| SMILES | Nc1ccc(Cl)c(C[C@@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C9H11ClN2O2/c10-7-2-1-6(11)3-5(7)4-8(12)9(13)14/h1-3,8H,4,11-12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | LWOGUJAUXGXLCV-MRVPVSSYSA-N |
| XLogP | 0.88 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|