C9H11BClNO4 — CID 167431302
(2R)-2-amino-3-(5-borono-2-chlorophenyl)propanoic acid (PubChem CID 167431302) has the molecular formula C9H11BClNO4 and a molecular weight of 243.46 g/mol. Its IUPAC name is (2R)-2-amino-3-(5-borono-2-chlorophenyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(5-borono-2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 167431302 |
| Molecular Formula | C9H11BClNO4 |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (2R)-2-amino-3-(5-borono-2-chlorophenyl)propanoic acid |
| SMILES | N[C@H](Cc1cc(B(O)O)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C9H11BClNO4/c11-7-2-1-6(10(15)16)3-5(7)4-8(12)9(13)14/h1-3,8,15-16H,4,12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | SDNCQWGWGNHEKE-MRVPVSSYSA-N |
| XLogP | -1.03 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|