C12H13Cl2NO4 — CID 18956364
2-amino-3-[2-(2-carboxyethyl)-4,5-dichlorophenyl]propanoic acid (PubChem CID 18956364) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 2-amino-3-[2-(2-carboxyethyl)-4,5-dichlorophenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-(2-carboxyethyl)-4,5-dichlorophenyl]propanoic acid |
|---|---|
| PubChem CID | 18956364 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-amino-3-[2-(2-carboxyethyl)-4,5-dichlorophenyl]propanoic acid |
| SMILES | NC(Cc1cc(Cl)c(Cl)cc1CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H13Cl2NO4/c13-8-3-6(1-2-11(16)17)7(4-9(8)14)5-10(15)12(18)19/h3-4,10H,1-2,5,15H2,(H,16,17)(H,18,19) |
| InChIKey | HRNMOWKFJHVJFE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |