C8H8Cl2N2O2 — CID 130041515
2-amino-3-(4,6-dichloro-3-pyridinyl)propanoic acid (PubChem CID 130041515) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 2-amino-3-(4,6-dichloro-3-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(4,6-dichloro-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 130041515 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2-amino-3-(4,6-dichloro-3-pyridinyl)propanoic acid |
| SMILES | NC(Cc1cnc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C8H8Cl2N2O2/c9-5-2-7(10)12-3-4(5)1-6(11)8(13)14/h2-3,6H,1,11H2,(H,13,14) |
| InChIKey | BDPSFPTZHXLYDC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|