C11H11Cl2NO4 — CID 116519906
2-[(4,6-dichloro-3-pyridinyl)methyl]-3-ethoxy-3-oxopropanoic acid (PubChem CID 116519906) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-[(4,6-dichloro-3-pyridinyl)methyl]-3-ethoxy-3-oxopropanoic acid.
| Compound Name | 2-[(4,6-dichloro-3-pyridinyl)methyl]-3-ethoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 116519906 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 2-[(4,6-dichloro-3-pyridinyl)methyl]-3-ethoxy-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(Cc1cnc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO4/c1-2-18-11(17)7(10(15)16)3-6-5-14-9(13)4-8(6)12/h4-5,7H,2-3H2,1H3,(H,15,16) |
| InChIKey | TTXIPDAQZUFQSH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|