C13H15Cl2NO2 — CID 102639223
ethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]-2-methylbut-3-enoate (PubChem CID 102639223) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is ethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]-2-methylbut-3-enoate.
| Compound Name | ethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]-2-methylbut-3-enoate |
|---|---|
| PubChem CID | 102639223 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | ethyl 2-[(4,6-dichloro-3-pyridinyl)methyl]-2-methylbut-3-enoate |
| SMILES | C=CC(C)(Cc1cnc(Cl)cc1Cl)C(=O)OCC |
| InChI | InChI=1S/C13H15Cl2NO2/c1-4-13(3,12(17)18-5-2)7-9-8-16-11(15)6-10(9)14/h4,6,8H,1,5,7H2,2-3H3 |
| InChIKey | LTQVRYPWOUBAFF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|