C13H24O2 — CID 102638995
ethyl 2-ethenyl-2,5,5-trimethylhexanoate (PubChem CID 102638995) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethyl 2-ethenyl-2,5,5-trimethylhexanoate.
| Compound Name | ethyl 2-ethenyl-2,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 102638995 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethyl 2-ethenyl-2,5,5-trimethylhexanoate |
| SMILES | C=CC(C)(CCC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C13H24O2/c1-7-13(6,11(14)15-8-2)10-9-12(3,4)5/h7H,1,8-10H2,2-6H3 |
| InChIKey | PJPLEQNHWNMJBS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|