C6H6Cl2N2O2S — CID 126971238
2-amino-3-(2,4-dichloro-1,3-thiazol-5-yl)propanoic acid (PubChem CID 126971238) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 2-amino-3-(2,4-dichloro-1,3-thiazol-5-yl)propanoic acid.
| Compound Name | 2-amino-3-(2,4-dichloro-1,3-thiazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 126971238 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 2-amino-3-(2,4-dichloro-1,3-thiazol-5-yl)propanoic acid |
| SMILES | NC(Cc1sc(Cl)nc1Cl)C(=O)O |
| InChI | InChI=1S/C6H6Cl2N2O2S/c7-4-3(13-6(8)10-4)1-2(9)5(11)12/h2H,1,9H2,(H,11,12) |
| InChIKey | DODFFLVUFCWUHR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |