C15H15Cl4N3O3S — CID 155059920
2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propanoic acid;dihydrochloride (PubChem CID 155059920) has the molecular formula C15H15Cl4N3O3S and a molecular weight of 459.18 g/mol. Its IUPAC name is 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propanoic acid;dihydrochloride.
| Compound Name | 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 155059920 |
| Molecular Formula | C15H15Cl4N3O3S |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 456.96 |
| IUPAC Name | 2-amino-3-[3,5-dichloro-7-(furan-2-ylmethylamino)thieno[3,2-b]pyridin-2-yl]propanoic acid;dihydrochloride |
| SMILES | Cl.Cl.NC(Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl)C(=O)O |
| InChI | InChI=1S/C15H13Cl2N3O3S.2ClH/c16-11-5-9(19-6-7-2-1-3-23-7)14-13(20-11)12(17)10(24-14)4-8(18)15(21)22;;/h1-3,5,8H,4,6,18H2,(H,19,20)(H,21,22);2*1H |
| InChIKey | ZVJLEQUNGYVQGU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|